CAS 35683-17-1

2,3-Dihydro-5,6,7-trihydroxy-2-phenyl-4H-1-benzopyran-4-one

Description:

2,3-Dihydro-5,6,7-trihydroxy-2-phenyl-4H-1-benzopyran-4-one, also known by its CAS number 35683-17-1, is a flavonoid compound characterized by its complex polyphenolic structure. This substance features a benzopyran core, which is a fused ring system comprising a benzene ring and a pyran ring, contributing to its aromatic properties. The presence of multiple hydroxyl groups (–OH) on the benzopyran structure enhances its solubility in polar solvents and contributes to its antioxidant activity. This compound is often studied for its potential biological activities, including anti-inflammatory, antimicrobial, and anticancer properties. Its phenolic nature allows it to participate in various chemical reactions, making it a subject of interest in both synthetic and natural product chemistry. Additionally, the compound's structural features may influence its interaction with biological systems, making it relevant in pharmacological research. Overall, 2,3-Dihydro-5,6,7-trihydroxy-2-phenyl-4H-1-benzopyran-4-one exemplifies the diverse functionalities of flavonoids in medicinal chemistry.

Formula: C₁₅H₁₂O₅

InChI: InChI=1S/C15H12O5/c16-9-6-11(8-4-2-1-3-5-8)20-12-7-10(17)14(18)15(19)13(9)12/h1-5,7,11,17-19H,6H2

InChI key: InChIKey=GPDJGLOROGNHJD-UHFFFAOYSA-N

SMILES: O=C1C=2C(OC(C1)C3=CC=CC=C3)=CC(O)=C(O)C2O

Synonyms:

• Flavanone, 5,6,7-trihydroxy-
• 4H-1-Benzopyran-4-one, 2,3-dihydro-5,6,7-trihydroxy-2-phenyl-
• 2,3-Dihydro-5,6,7-trihydroxy-2-phenyl-4H-1-benzopyran-4-one

Dihydrobaicalein

CAS: 35683-17-1

Dihydrobaicalein

Purity: ≥98%

Molecular weight: 272.25g/mol

Ref: 54-BUP00798

Dihydrobaicalein

CAS: 35683-17-1

Dihydrobaicalein is a natural product from Scutellaria baicalensis, a PLK1 inhibitor (IC50:6.3 μM).Dihydrobaicalein inhibits VRK2 and PLK2.

Formula: C₁₅H₁₂O₅

Purity: 99.96%

Color and Shape: Solid

Molecular weight: 272.25

Ref: TM-TN3848

Dihydrobaicalein

CAS: 35683-17-1

Dihydrobaicalein is a flavonoid compound, which is a type of polyphenolic molecule typically derived from plants. It is primarily sourced from the roots of Scutellaria baicalensis, also known as Chinese skullcap, a traditional medicinal herb. The mode of action of dihydrobaicalein involves its antioxidant and anti-inflammatory properties. It achieves this by scavenging free radicals and modulating various signaling pathways, including inhibiting the production of pro-inflammatory cytokines and enzymes such as COX-2 and iNOS.

Formula: C₁₅H₁₂O₅

Purity: Min. 95%

Molecular weight: 272.25 g/mol

Ref: 3D-KBA68317