CAS 3569-19-5
:1H-Indole-3,5,6-triol
Description:
1H-Indole-3,5,6-triol, with the CAS number 3569-19-5, is a chemical compound that belongs to the indole family, characterized by a bicyclic structure containing a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. This compound features three hydroxyl (-OH) groups located at the 3, 5, and 6 positions of the indole structure, which significantly influences its chemical properties and biological activity. The presence of these hydroxyl groups enhances its solubility in water and contributes to its potential as a bioactive molecule. 1H-Indole-3,5,6-triol has been studied for its antioxidant properties and potential therapeutic applications, particularly in the fields of pharmacology and biochemistry. Its structural characteristics allow for various interactions with biological systems, making it a subject of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its practical applications.
Formula:C8H7NO3
InChI:InChI=1S/C8H7NO3/c10-6-1-4-5(2-7(6)11)9-3-8(4)12/h1-3,9-12H
InChI key:InChIKey=TYTJJQZBTLMGRT-UHFFFAOYSA-N
SMILES:OC=1C=2C(=CC(O)=C(O)C2)NC1
Synonyms:- Noradrenolutin
- 1H-Indole-3,5,6-triol
- 3,5,6-Trihydroxyindole
- Indole-3,5,6-triol
- Norepinephrine Impurity 40
- Norepinephrine Impurity 40 Q: What is the CAS Number of
- Valine Impurity 57
- Norepinephrine Impurity 40Q: What is
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

