CAS 3569-20-8
:3-(1H-indol-3-yl)butanoic acid
Description:
3-(1H-indol-3-yl)butanoic acid, also known as indole-3-butyric acid (IBA), is a naturally occurring plant hormone belonging to the auxin class. It plays a crucial role in regulating plant growth and development, particularly in processes such as root formation and elongation. The compound features an indole ring structure, which is a bicyclic structure composed of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. IBA is typically a white to off-white crystalline solid, and it is soluble in organic solvents like ethanol and dimethyl sulfoxide, but has limited solubility in water. Its chemical properties include the ability to promote root initiation in cuttings, making it a valuable substance in horticulture and agriculture. Additionally, IBA has been studied for its potential applications in plant tissue culture and as a growth regulator. Safety data indicates that while it is generally regarded as safe for use in agricultural applications, appropriate handling and usage guidelines should be followed to minimize any potential risks.
Formula:C12H13NO2
InChI:InChI=1/C12H13NO2/c1-8(6-12(14)15)10-7-13-11-5-3-2-4-9(10)11/h2-5,7-8,13H,6H2,1H3,(H,14,15)
SMILES:CC(CC(=O)O)c1c[nH]c2ccccc12
Synonyms:- 1H-Indole-3-propanoic acid, beta-methyl-
- 3-(1H-Indol-3-yl)butanoic acid
- 1H-Indole-3-propanoic acid, β-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-(1H-Indol-3-yl)butanoic acid
CAS:<p>3-(1H-Indol-3-yl)butanoic acid is an antibiotic that inhibits the activity of lipases and other enzymes that are involved in the digestion of fats. It is also an enantiomerically pure product, which means that it has a single chiral center and only one stereoisomer is present in the compound. 3-(1H-Indol-3-yl)butanoic acid has been shown to inhibit the growth of pseudomonas fluorescens, which is a bacterium that causes infections in humans. The enzyme hydrolysis of this antibiotic can be done by either microorganisms or enzymes from human cells.</p>Formula:C12H13NO2Purity:Min. 95%Molecular weight:203.24 g/mol
