CAS 3569-26-4
:indopine
Description:
Indopine, with the CAS number 3569-26-4, is a chemical compound that belongs to the class of organic compounds known as indoles. It is characterized by its bicyclic structure, which consists of a fused benzene and pyrrole ring. Indopine is typically recognized for its role in various chemical reactions and its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound exhibits properties such as moderate solubility in organic solvents and may have specific interactions with biological systems, making it of interest in research related to drug design and synthesis. Its molecular structure contributes to its reactivity and potential biological activity, which can include effects on neurotransmitter systems. As with many organic compounds, the handling and usage of indopine require appropriate safety measures due to its chemical nature. Further studies are often conducted to explore its full range of properties and applications in various fields, including biochemistry and pharmacology.
Formula:C23H28N2
InChI:InChI=1/C23H28N2/c1-2-6-19(7-3-1)12-15-25-16-13-20(14-17-25)10-11-21-18-24-23-9-5-4-8-22(21)23/h1-9,18,20,24H,10-17H2
SMILES:c1ccc(cc1)CCN1CCC(CCc2c[nH]c3ccccc23)CC1
Synonyms:- Indopine [INN]
- 3-(2-(1-Phenethyl-4-piperidyl)ethyl)indol
- 3-(2-(1-Phenethyl-4-piperidyl)ethyl)indole
- Indopinum
- Unii-J57707Ekbi
- Indole, 3-(2-(1-Phenethyl-4-piperidyl)ethyl)-
- 3-{2-[1-(2-phenylethyl)piperidin-4-yl]ethyl}-1H-indole
- Indopine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Indopine
CAS:Controlled ProductApplications Indopine is a useful research chemical for organic synthesis and other chemical processes.
References Gray, A. ., et al.: J. Org. Chem., 26, 3368 (1961), Miyazaki, Y.,et al.: Org. Biomol. Chem., 4, 2529 (2006)Formula:C23H28N2Color and Shape:NeatMolecular weight:332.482
