CAS 3569-82-2

2,6,7-trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one

Description:

2,6,7-Trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one, commonly known as a xanthone derivative, is a chemical compound characterized by its complex structure featuring multiple hydroxyl groups and a xanthene backbone. This compound typically exhibits a range of biological activities, including antioxidant properties, which are attributed to the presence of hydroxyl groups that can donate electrons and neutralize free radicals. It is often studied for its potential applications in pharmaceuticals and as a dye due to its vibrant color. The presence of the 2-hydroxyphenyl group enhances its solubility and reactivity, making it useful in various chemical reactions. Additionally, xanthone derivatives are known for their fluorescence, which can be exploited in analytical chemistry and biological imaging. The compound's stability and reactivity can vary depending on environmental conditions such as pH and temperature, influencing its practical applications in research and industry. Overall, 2,6,7-trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one is a versatile compound with significant interest in both scientific research and potential industrial applications.

Formula: C₁₉H₁₂O₆

InChI: InChI=1/C19H12O6/c20-12-4-2-1-3-9(12)19-10-5-13(21)15(23)7-17(10)25-18-8-16(24)14(22)6-11(18)19/h1-8,20-23H

SMILES: c1ccc(c(c1)c1c2cc(c(cc2oc2cc(=O)c(cc12)O)O)O)O

Synonyms:

• 3H-xanthen-3-one, 2,6,7-trihydroxy-9-(2-hydroxyphenyl)-
• 2,6,7-Trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one

2,6,7-Trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one

CAS: 3569-82-2

2,6,7-Trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one

Purity: 98%

Molecular weight: 336.3g/mol

Ref: 54-OR1063830

2,6,7-Trihydroxy-9-(2-hydroxyphenyl)-3H-xanthen-3-one

CAS: 3569-82-2

Purity: 95%

Color and Shape: Solid

Molecular weight: 336.2990112

Ref: 10-F773274

Salicylfluorone

CAS: 3569-82-2

Salicylfluorone is a molybdenum and copper complex that is used as an antimicrobial agent. It has been shown to be effective against nitrite-producing bacteria, such as Enterobacteriaceae and Pseudomonas aeruginosa. Salicylfluorone inhibits the activity of bacterial enzymes by binding to their active sites, preventing the formation of reactive oxygen species in vitro. The reaction mechanism is not well understood but it is proposed that salicylfluorone may act by forming a hydrogen bond with the enzyme or by binding to a potential drug target site on the enzyme or its substrate. Salicylfluorone has not been tested in vivo but there are indications from in vitro assays that it may have therapeutic potential for treating chronic inflammatory diseases such as rheumatoid arthritis.

Formula: C₁₉H₁₂O₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 336.29 g/mol

Ref: 3D-FS97426