CAS 35691-93-1
:1H-Pyrazole-4-carboxylic acid, 3,5-dimethyl-, ethyl ester
Description:
1H-Pyrazole-4-carboxylic acid, 3,5-dimethyl-, ethyl ester, with CAS number 35691-93-1, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group and an ethyl ester moiety, contributing to its reactivity and solubility properties. The presence of the 3,5-dimethyl substituents on the pyrazole ring enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature are of interest in medicinal chemistry and agricultural applications, often exhibiting various pharmacological properties. The ester functionality allows for potential hydrolysis to release the corresponding carboxylic acid, which can be relevant in metabolic pathways. Additionally, the compound's stability, solubility in organic solvents, and potential for forming hydrogen bonds make it suitable for various synthetic applications. Overall, 1H-Pyrazole-4-carboxylic acid, 3,5-dimethyl-, ethyl ester is a versatile compound with significant implications in chemical research and development.
Formula:C8H12N2O2
InChI:InChI=1S/C8H12N2O2/c1-4-12-8(11)7-5(2)9-10-6(7)3/h4H2,1-3H3,(H,9,10)
InChI key:InChIKey=BCKARVLFIJPHQU-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(C)=NNC1C
Synonyms:- 1H-Pyrazole-4-carboxylic acid, 3,5-dimethyl-, ethyl ester
- 3,5-Dimethyl-1H-pyrazole-4-carboxylic acid ethyl ester
- Ethyl 3,5-dimethyl-1H-pyrazole-4-carboxylate
- Ethyl 3,5-dimethylpyrazole-4-carboxylate
- 3,5-Dimethylpyrazole-4-carboxylic acid ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 3,5-dimethyl-1H-pyrazole-4-carboxylate
CAS:Formula:C8H12N2O2Purity:97%Color and Shape:SolidMolecular weight:168.1931Ethyl 3,5-dimethyl-1H-pyrazole-4-carboxylate
CAS:Ethyl 3,5-dimethyl-1H-pyrazole-4-carboxylateFormula:C8H12N2O2Purity:≥95%Color and Shape:PowderMolecular weight:168.19g/molEthyl 3,5-dimethyl-1H-pyrazole-4-carboxylate
CAS:Formula:C8H12N2O2Purity:95%Color and Shape:SolidMolecular weight:168.196Ethyl 3,5-dimethyl-1H-pyrazole-4-carboxylate
CAS:Ethyl 3,5-dimethyl-1H-pyrazole-4-carboxylate is a chemical compound that belongs to the group of organic compounds. It is a colorless liquid with a pungent odor and a boiling point of 150 degrees Celsius. It is soluble in water, ethanol, and ether. Ethyl 3,5-dimethyl-1H-pyrazole-4-carboxylate can be used as an amine transfer agent and has been shown to react with hydroxyl ions under acidic conditions. The reaction rate increases when the concentration of acid solutions increase. This chemical also reacts with inorganic anions to form salts.Formula:C8H12N2O2Purity:Min. 95%Molecular weight:168.19 g/mol



