CAS 35696-77-6
:2,4-Dimethoxyphenylthiourea
Description:
2,4-Dimethoxyphenylthiourea is an organic compound characterized by its thiourea functional group, which consists of a sulfur atom double-bonded to a carbon atom and single-bonded to a nitrogen atom. This compound features two methoxy groups (-OCH3) attached to a phenyl ring at the 2 and 4 positions, contributing to its unique chemical properties. It is typically a white to off-white solid and is soluble in organic solvents. The presence of the methoxy groups enhances its electron-donating ability, which can influence its reactivity and interactions with other chemical species. 2,4-Dimethoxyphenylthiourea is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as well as in various organic synthesis processes. Its CAS number, 35696-77-6, is a unique identifier that facilitates the tracking and regulation of this compound in scientific literature and chemical databases. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H12N2O2S
InChI:InChI=1/C9H12N2O2S/c1-12-6-3-4-7(11-9(10)14)8(5-6)13-2/h3-5H,1-2H3,(H3,10,11,14)
SMILES:COc1ccc(c(c1)OC)NC(=N)S
Synonyms:- 1-(2,4-Dimethoxyphenyl)-2-Thiourea
- 1-(2,4-Dimethoxyphenyl)Thiourea
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(2,4-Dimethoxyphenyl)thiourea
CAS:Formula:C9H12N2O2SPurity:95%Color and Shape:SolidMolecular weight:212.26881-(2,4-Dimethoxyphenyl)-2-thiourea
CAS:1-(2,4-Dimethoxyphenyl)-2-thiourea
Molecular weight:212.26878g/mol1-(2,4-Dimethoxyphenyl)-2-thiourea
CAS:1-(2,4-Dimethoxyphenyl)-2-thiourea is a lead compound for the development of opioid analgesics. It has shown to be an effective analgesic in animal models and has been found to have low side effects. This drug interacts with the μ-opioid receptor and activates it by changing its conformation. This activation mechanism is different from that of other opioids, which typically inhibit the receptor's activity. The activation mechanism of 1-(2,4-dimethoxyphenyl)-2-thiourea is believed to be due to structural modifications at the site of the receptor that promote signal transduction. This drug also acts as a competitive antagonist at the μ-opioid receptor, which may contribute to its antinociceptive properties.
Formula:C9H12N2O2SPurity:Min. 95%Molecular weight:212.27 g/mol




