CymitQuimica logo

CAS 35697-10-0

:

5-Hydroxy-2-tetralone

Description:
5-Hydroxy-2-tetralone, with the CAS number 35697-10-0, is an organic compound characterized by its bicyclic structure, which consists of a fused benzene and cyclopentane ring. This compound features a hydroxyl group (-OH) at the 5-position and a ketone group (C=O) at the 2-position of the tetralone structure. It is typically a white to off-white solid at room temperature and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic nature. The presence of the hydroxyl group contributes to its potential reactivity, making it a candidate for various chemical reactions, including oxidation and substitution. 5-Hydroxy-2-tetralone is of interest in medicinal chemistry and organic synthesis, as it can serve as a precursor for the synthesis of more complex molecules. Its biological properties and potential applications in pharmaceuticals are subjects of ongoing research, highlighting its significance in the field of organic chemistry.
Formula:C10H10O2
InChI:InChI=1/C10H10O2/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h1-3,12H,4-6H2
InChI key:SPOWVZSMEMISBG-UHFFFAOYSA-N
SMILES:c1cc2CC(=O)CCc2c(c1)O
Synonyms:
  • 5-Hydroxy-3,4-dihydronaphthalen-2(1H)-one
Found 5 products.