CAS 35697-15-5
:cis-1,2,3,4-Tetrahydro-5-(oxiranylmethoxy)-2,3-naphthalenediol
Description:
Cis-1,2,3,4-Tetrahydro-5-(oxiranylmethoxy)-2,3-naphthalenediol, with the CAS number 35697-15-5, is a chemical compound characterized by its complex bicyclic structure, which includes a naphthalene core and a tetrahydrofuran moiety. This compound features multiple functional groups, including hydroxyl (-OH) and an epoxide (-O-) group, which contribute to its reactivity and potential biological activity. The presence of the cis configuration indicates specific stereochemistry that can influence its interactions and properties. Typically, compounds like this may exhibit solubility in organic solvents and may have limited solubility in water due to their hydrophobic naphthalene structure. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where the naphthalene framework is often associated with various biological activities. However, detailed studies on its specific properties, reactivity, and biological effects would be necessary to fully understand its potential uses and safety profile.
Formula:C13H16O4
InChI:InChI=1/C13H16O4/c14-11-4-8-2-1-3-13(10(8)5-12(11)15)17-7-9-6-16-9/h1-3,9,11-12,14-15H,4-7H2/t9?,11-,12+/m0/s1
Synonyms:- 2,3-naphthalenediol, 1,2,3,4-tetrahydro-5-(oxiranylmethoxy)-, (2S,3R)-
- cis-1,2,3,4-Tetrahydro-5-(2,3-epoxypropoxy)-2,3-naphthalenediol
- (2S,3R)-5-(oxiran-2-ylmethoxy)-1,2,3,4-tetrahydronaphthalene-2,3-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
