CAS 3572-44-9
:3-Amino-5-nitro-o-toluamide
Description:
3-Amino-5-nitro-o-toluamide, with the CAS number 3572-44-9, is an organic compound characterized by the presence of an amino group (-NH2) and a nitro group (-NO2) attached to a toluamide structure. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The nitro group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and reductions. The presence of both amino and nitro functionalities suggests that it may exhibit biological activity, potentially serving as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Additionally, the compound's structure indicates that it may have specific electronic properties, influencing its behavior in chemical reactions and interactions with other substances. Safety data should be consulted, as nitro compounds can sometimes be hazardous, and appropriate handling procedures should be followed in laboratory settings.
Formula:C8H9N3O3
InChI:InChI=1S/C8H9N3O3/c1-4-6(8(10)12)2-5(11(13)14)3-7(4)9/h2-3H,9H2,1H3,(H2,10,12)
InChI key:InChIKey=RBLRQBGOUCRKRT-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(N(=O)=O)=CC(N)=C1C
Synonyms:- 3-Amino-5-nitro-o-toluamide
- 3572-44-9
- Benzamide, 3-amino-2-methyl-5-nitro-
- o-Toluamide, 3-amino-5-nitro-
- Anot
- 3-Amino-2-methyl-5-nitrobenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
3-ANOT
CAS:3-ANOT is a metabolite derived from Dinitolmide, a widely employed nitroamide coccidiostat in the poultry industry.Formula:C8H9N3O3Color and Shape:SolidMolecular weight:195.183-Amino-2-methyl-5-nitrobenzamide
CAS:Controlled ProductFormula:C8H9N3O3Color and Shape:Yellow To BrownMolecular weight:195.183-Amino-5-nitro-o-toluamide
CAS:Controlled ProductApplications 3-Amino-5-nitro-o-toluamide is a metabolite of the veterinary drug zoalene.
References Wu, Y.; et al.: Fenxi Huaxue, 39, 1903 (2011).Formula:C8H9N3O3Color and Shape:NeatMolecular weight:195.18



