CAS 3572-64-3
:(±)-9,10-Dihydrojasmonic acid
Description:
(±)-9,10-Dihydrojasmonic acid is a naturally occurring compound that belongs to the class of jasmonates, which are important plant hormones involved in various physiological processes, including growth, development, and stress responses. This compound is characterized by its bicyclic structure, which features a cyclopentane ring fused to a cyclohexene moiety. It is typically found in plants and is known for its role in regulating plant defense mechanisms and promoting the production of secondary metabolites. The substance exhibits a chiral nature, with two enantiomers, which can influence its biological activity. (±)-9,10-Dihydrojasmonic acid is often studied for its potential applications in agriculture, particularly in enhancing plant resilience to environmental stressors and pests. Additionally, it has been investigated for its effects on gene expression related to plant defense pathways. Its CAS number, 3572-64-3, is used for identification in chemical databases and regulatory contexts. Overall, this compound plays a significant role in plant biology and has potential implications in agricultural practices.
Formula:C12H20O3
InChI:InChI=1S/C12H20O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h9-10H,2-8H2,1H3,(H,14,15)
InChI key:InChIKey=PQEYTAGBXNEUQL-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1C(CCCCC)C(=O)CC1
Synonyms:- (3-Oxo-2-Pentylcyclopentyl)Acetic Acid
- (±)-9,10-Dihydrojasmonic acid
- 2-(3-Oxo-2-pentylcyclopentyl)acetic acid
- 2-Pentyl-3-oxocyclopentyl-1-acetic acid
- 2-Pentyl-3-oxocyclopentylacetic acid
- 2-n-Pentyl-3-oxocyclopentylacetic acid
- 3-Carboxymethyl-2-pentylcyclopentanone
- Cyclopentaneacetic acid, 3-oxo-2-pentyl-
- 3-Oxo-2-pentylcyclopentaneacetic acid
- 3-Oxo-2-pentylcyclopentaneacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(+/-)-Dihydrojasmonic acid
CAS:Formula:C11H18O3Purity:98%Color and Shape:LiquidMolecular weight:198.25883-oxo-2-pentylcyclopentaneacetic acid
CAS:3-oxo-2-pentylcyclopentaneacetic acidPurity:98%Molecular weight:212.29g/molDihydrojasmonic acid
CAS:<p>Dihydrojasmonic acid is a plant growth regulator.</p>Formula:C12H20O3Color and Shape:SolidMolecular weight:212.29Dihydrojasmonic Acid
CAS:Formula:C12H20O3Purity:>98.0%(T)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:212.29(±)-9,10-Dihydrojasmonic Acid
CAS:<p>Applications (±)-9,10-Dihydrojasmonic Acid can be used as analyte in biological and analytical study for UHPLC-MS/MS based target profiling of stress-induced phytohormones including jasmonic acid and its precursors and amino acid conjugates.<br>References Flokova, K., et al.: Phytochemistry, 105, 147-157 (2014)<br></p>Formula:C12H20O3Color and Shape:NeatMolecular weight:212.29






