CAS 357263-13-9: 1-(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-[(2R)-2-methyl-4-(phenylcarbonyl)piperazin-1-yl]-2-oxoethanone
Description:The chemical substance known as 1-(4-methoxy-1H-pyrrolo[2,3-b]pyridin-3-yl)-2-[(2R)-2-methyl-4-(phenylcarbonyl)piperazin-1-yl]-2-oxoethanone, with the CAS number 357263-13-9, is a complex organic compound characterized by its multi-cyclic structure and functional groups. It features a pyrrolo[2,3-b]pyridine moiety, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of a methoxy group enhances its solubility and may influence its pharmacokinetic properties. Additionally, the piperazine ring, substituted with a phenylcarbonyl group, suggests potential interactions with biological targets, making it of interest in drug development. The compound's structure indicates it may exhibit specific reactivity due to the ketone functional group, which can participate in various chemical reactions. Overall, this compound's unique structural features and functional groups position it as a candidate for further investigation in therapeutic applications, particularly in areas related to neuropharmacology or oncology.
Formula:C22H22N4O4
InChI:InChI=1/C22H22N4O4/c1-14-13-25(21(28)15-6-4-3-5-7-15)10-11-26(14)22(29)19(27)16-12-24-20-18(16)17(30-2)8-9-23-20/h3-9,12,14H,10-11,13H2,1-2H3,(H,23,24)/t14-/m1/s1
- Synonyms:
- 1,2-ethanedione, 1-[(2R)-4-benzoyl-2-methyl-1-piperazinyl]-2-(4-methoxy-7H-pyrrolo[2,3-b]pyridin-3-yl)-
- 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(4-methoxy-7H-pyrrolo[2,3-b]pyridin-3-yl)ethane-1,2-dione