CymitQuimica logo

CAS 357263-40-2

:

4-Methoxy-1H-pyrrolo[2,3-c]pyridine

Description:
4-Methoxy-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its pyrrole and pyridine rings fused together, with a methoxy group (-OCH3) attached to the pyrrole nitrogen. This compound typically exhibits a molecular formula that reflects its complex structure, contributing to its unique chemical properties. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the methoxy group can influence its solubility, reactivity, and interaction with biological targets. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and mass spectrometry, aiding in its identification and characterization. Its synthesis often involves multi-step organic reactions, and it may serve as a building block for more complex molecules in pharmaceutical research. As with many heterocycles, it may also display interesting electronic properties due to the delocalization of electrons within its aromatic system.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c1-11-8-5-9-4-7-6(8)2-3-10-7/h2-5,10H,1H3
InChI key:InChIKey=UPDSOLUKSUHRDC-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(NC=C2)=CN=C1
Synonyms:
  • 4-Methoxy-1H-pyrrolo[2,3-c]pyridine
  • 4-Methoxy-6-azaindole
  • 1H-Pyrrolo[2,3-c]pyridine, 4-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.