CAS 357263-41-3: 7-Chloro-1H-pyrrolo[2,3-c]pyridine

Description:7-Chloro-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, incorporating a chlorine atom at the 7-position. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, reflecting its aromatic nature. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the chlorine atom can influence its reactivity and interaction with biological targets, potentially enhancing its pharmacological properties. Additionally, this compound may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of the chlorine substituent. As a result, 7-Chloro-1H-pyrrolo[2,3-c]pyridine is studied for its potential applications in pharmaceuticals, particularly in the development of compounds with therapeutic effects against various diseases. Safety and handling precautions are essential when working with this substance, as with many chemical compounds, to mitigate any health risks associated with exposure.

Formula:C₇H₅ClN₂

InChI:InChI=1S/C7H5ClN2/c8-7-6-5(1-3-9-6)2-4-10-7/h1-4,9H

InChI key:InChIKey=HOHKYYCVFMEBGG-UHFFFAOYSA-N

SMILES:ClC1=NC=CC=2C=CNC12

Synonyms:
1H-Pyrrolo[2,3-c]pyridine, 7-chloro-
7-Chloro-1H-pyrrolo[2,3-c]pyridine
7-Chloro-6-azaindole

Found 4 products.

Product data	Purity	Price range	Estimated delivery
7-Chloro-1H-pyrrolo[2,3-c]pyridine REF: IN-DA003NE3CAS: 357263-41-3	98%	To inquire	Tue 15 Apr 25
7-Chloro-1h-pyrrolo[2,3-c]pyridine REF: 54-OR345082CAS: 357263-41-3	98%	32.00 €~1,211.00 €	Wed 16 Apr 25
7-Chloro-1H-pyrrolo[2,3-c]pyridine REF: 10-F040181CAS: 357263-41-3	97.0%	25.00 €~306.00 €	Mon 21 Apr 25
7-Chloro-1H-pyrrolo[2,3-c]pyridine REF: 3D-FC139921CAS: 357263-41-3	Min. 95%	- - -	Discontinued product