CAS 3573-50-0: Deoxyglucose 6-phosphate

Description:Deoxyglucose 6-phosphate, also known as 2-deoxy-D-glucose 6-phosphate, is a phosphorylated derivative of deoxyglucose. It is a monosaccharide that plays a significant role in cellular metabolism, particularly in glycolysis and energy production. The compound is characterized by the presence of a phosphate group attached to the sixth carbon of the deoxyglucose molecule, which influences its biochemical properties and interactions. Deoxyglucose 6-phosphate is often utilized in research and clinical settings, particularly in studies related to glucose metabolism and cancer, as it can inhibit glycolysis and affect cellular energy pathways. The substance is typically a white crystalline solid and is soluble in water, making it suitable for various laboratory applications. Its CAS number, 3573-50-0, is a unique identifier that facilitates the identification and procurement of this compound in scientific research. Overall, deoxyglucose 6-phosphate is an important molecule in biochemistry, with implications for understanding metabolic processes and developing therapeutic strategies.

Formula:C₆H₁₃O₈P

InChI:InChI=1S/C6H13O8P/c7-2-1-4(8)6(10)5(9)3-14-15(11,12)13/h2,4-6,8-10H,1,3H2,(H2,11,12,13)/t4-,5-,6+/m1/s1

InChI key:InChIKey=MBPFNOMGYSRGQZ-PBXRRBTRSA-N

SMILES:O=CCC(O)C(O)C(O)COP(=O)(O)O