CAS 3575-86-8
:Pyridinium, 1,1′-(thiodimethylene)bis[4-formyl-, dichloride, dioxime
Description:
Pyridinium, 1,1′-(thiodimethylene)bis[4-formyl-, dichloride, dioxime, known by its CAS number 3575-86-8, is a chemical compound characterized by its pyridinium structure, which includes a nitrogen-containing aromatic ring. This compound features a thiodimethylene bridge, linking two 4-formyl groups, which are aldehyde functional groups that can participate in various chemical reactions, particularly in condensation and complexation processes. The presence of dichloride indicates that the compound has two chlorine atoms, which can influence its reactivity and solubility. Additionally, the dioxime functionality suggests the presence of two oxime groups, which are known for their ability to form chelates with metal ions, making this compound potentially useful in coordination chemistry. Overall, the unique combination of functional groups in this compound may impart specific properties, such as reactivity towards nucleophiles and potential applications in organic synthesis or as a ligand in coordination complexes. However, detailed studies would be necessary to fully understand its behavior and applications in various chemical contexts.
Formula:C14H16N4O2S·2Cl
InChI:InChI=1S/C14H14N4O2S.2ClH/c19-15-9-13-1-5-17(6-2-13)11-21-12-18-7-3-14(4-8-18)10-16-20;;/h1-10H,11-12H2;2*1H
InChI key:InChIKey=HXYZQULFTRYLCX-UHFFFAOYSA-N
SMILES:C(SC[N+]=1C=CC(C=NO)=CC1)[N+]=2C=CC(C=NO)=CC2.[Cl-]
Synonyms:- 1,1′-(Thiodimethylene)bis[4-formylpyridinium chloride], dioxime
- Pyridinium, 1,1′-(thiodimethylene)bis[4-formyl-, dichloride, dioxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
