CAS 35750-02-8

2-(3-chloro-2-oxopropyl)-1H-isoindole-1,3(2H)-dione

Description:

2-(3-chloro-2-oxopropyl)-1H-isoindole-1,3(2H)-dione, with the CAS number 35750-02-8, is a chemical compound that belongs to the class of isoindole derivatives. This substance features a bicyclic structure that includes an isoindole moiety, which is characterized by a fused benzene and pyrrole ring. The presence of a chloro group and a ketone functional group contributes to its reactivity and potential applications in organic synthesis. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for various chemical transformations, making it of interest in medicinal chemistry and material science. Additionally, the presence of the chloro substituent can influence its biological activity and interaction with other molecules. As with many chemical substances, safety precautions should be taken when handling this compound, as it may pose health risks or environmental hazards.

Formula: C₁₁H₈ClNO₃

InChI: InChI=1/C11H8ClNO3/c12-5-7(14)6-13-10(15)8-3-1-2-4-9(8)11(13)16/h1-4H,5-6H2

SMILES: c1ccc2c(c1)C(=O)N(CC(=O)CCl)C2=O

Synonyms:

• 1H-isoindole-1,3(2H)-dione, 2-(3-chloro-2-oxopropyl)-

2-(3-Chloro-2-oxopropyl)isoindoline-1,3-dione

CAS: 35750-02-8

Formula: C₁₁H₈ClNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 237.6391

Ref: IN-DA0079L1

N-(3-Chloro-2-oxoprop-1-yl)phthalimide

CAS: 35750-02-8

N-(3-Chloro-2-oxoprop-1-yl)phthalimide

Purity: 95%

Molecular weight: 237.64g/mol

Ref: 54-OR40332