CAS 35757-19-8
:2-bromo-3-nitrobenzamide
Description:
2-Bromo-3-nitrobenzamide is an organic compound characterized by the presence of a bromine atom and a nitro group attached to a benzene ring, which is further substituted with an amide functional group. This compound typically appears as a crystalline solid and is soluble in organic solvents. The bromine atom introduces a halogen, which can influence the compound's reactivity and polarity, while the nitro group is known for its electron-withdrawing properties, affecting the compound's overall electronic characteristics. The amide functional group contributes to the compound's ability to participate in hydrogen bonding, which can impact its solubility and boiling point. 2-Bromo-3-nitrobenzamide may be used in various chemical syntheses and research applications, particularly in the fields of medicinal chemistry and materials science. Its unique combination of functional groups allows for diverse reactivity, making it a valuable intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks typical of halogenated and nitro compounds.
Formula:C7H5BrN2O3
InChI:InChI=1/C7H5BrN2O3/c8-6-4(7(9)11)2-1-3-5(6)10(12)13/h1-3H,(H2,9,11)
SMILES:c1cc(c(c(c1)N(=O)=O)Br)C(=N)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromo-3-nitrobenzamide
CAS:2-Bromo-3-nitrobenzamideFormula:C7H5BrN2O3Purity:≥95%Color and Shape: off white to faint yellow solidMolecular weight:245.03g/mol2-Bromo-3-nitrobenzamide
CAS:2-Bromo-3-nitrobenzamide (2-BNBA) is an organic compound that has been shown to have insecticidal properties. It is a quinoline derivative with a cinnabarinus structure and a benzyl group on the nitrogen atom. 2-BNBA was synthesized by modifying the pharmacophore of the natural product cinnabarinus, which is found in the leaves of Cinnamomum zeylanicum. The modification of this pharmacophore led to increased insecticidal activity against tetranychus and other insects. The target compounds for 2-BNBA are sulfide, which are found in cells and tissues of insects such as tetranychus. 2-BNBA inhibits the synthesis of proteins and DNA, leading to death by accumulation of reactive oxygen species within cells.Formula:C7H5N2O3BrPurity:Min. 95%Molecular weight:245.03 g/mol



