CAS 35762-87-9
:pyrimidine-2-sulfonyl fluoride
Description:
Pyrimidine-2-sulfonyl fluoride is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The sulfonyl fluoride functional group (-SO2F) is attached to the second carbon of the pyrimidine ring, imparting unique reactivity and properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its role as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl-containing compounds. Pyrimidine-2-sulfonyl fluoride is also utilized in medicinal chemistry for the development of pharmaceuticals, owing to its ability to act as a sulfonylating agent. Due to the presence of the sulfonyl fluoride group, it can be reactive towards nucleophiles, making it valuable in various chemical transformations. Safety precautions should be observed when handling this compound, as it may be toxic and irritant.
Formula:C4H3FN2O2S
InChI:InChI=1/C4H3FN2O2S/c5-10(8,9)4-6-2-1-3-7-4/h1-3H
SMILES:c1cnc(nc1)S(=O)(=O)F
Synonyms:- 2-Pyrimidinesulfonyl fluoride
- T6N Cnj Bswf
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Pyrimidine-2-sulfonyl Fluoride
CAS:Formula:C4H3FN2O2SPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:162.142-Pyrimidinesulfonylfluoride
CAS:Formula:C4H3FN2O2SPurity:98%Color and Shape:SolidMolecular weight:162.1422Pyrimidine-2-sulphonyl fluoride
CAS:Pyrimidine-2-sulphonyl fluoridePurity:98%Color and Shape:SolidMolecular weight:162.14g/molPyrimidine-2-sulfonyl Fluoride
CAS:Stability Moisture Sensitive, Air Sensitive
Applications pyrimidine-2-sulfonyl fluoride (cas# 35762-87-9) is a useful research chemical.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C4H3FN2O2SColor and Shape:NeatMolecular weight:162.14




