CAS 35764-54-6

6-methoxy-1,2,3,4-tetrahydro-9H-pyrido-(3,4-B)ind

Description:

6-Methoxy-1,2,3,4-tetrahydro-9H-pyrido(3,4-b)indole, with the CAS number 35764-54-6, is a chemical compound that belongs to the class of indole derivatives. This substance features a fused bicyclic structure that includes a pyridine and an indole moiety, contributing to its unique properties. The presence of a methoxy group enhances its solubility and may influence its biological activity. Typically, compounds of this nature exhibit a range of pharmacological effects, including potential neuroactive properties, which have garnered interest in medicinal chemistry. The tetrahydro configuration indicates that the compound is saturated, which can affect its reactivity and interaction with biological targets. Additionally, the compound's structural characteristics may allow for various functionalizations, making it a candidate for further research in drug development and synthesis. As with many organic compounds, its stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature.

Formula: C₁₂H₁₅ClN₂O

InChI: InChI=1/C12H14N2O.ClH/c1-15-8-2-3-11-10(6-8)9-4-5-13-7-12(9)14-11;/h2-3,6,13-14H,4-5,7H2,1H3;1H

SMILES: COc1ccc2c(c1)c1CCNCc1[nH]2.Cl

Synonyms:

• 6-Methoxy-1,2,3,4-tetrahydro-9H-pyrido[3,4-b]indole hydrochloride
• 6-methoxy-2,3,4,9-tetrahydro-1H-beta-carboline hydrochloride (1:1)

6-Methoxy-1,2,3,4-tetrahydro-9H-pyrido[3,4-b]indole hydrochloride

CAS: 35764-54-6

Formula: C₁₂H₁₄N₂O·HCl

Molecular weight: 238.71

Ref: 7W-GT4209