CymitQuimica logo

CAS 35779-35-2

:

dipyridin-3-ylmethanone

Description:
Dipyridin-3-ylmethanone, also known by its CAS number 35779-35-2, is an organic compound characterized by the presence of two pyridine rings and a ketone functional group. This compound typically exhibits a pale yellow to light brown solid appearance and is soluble in polar organic solvents. Its molecular structure features a central carbon atom bonded to a carbonyl group (C=O) and two pyridine rings, which contribute to its aromatic properties and potential for engaging in various chemical reactions. Dipyridin-3-ylmethanone may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The compound's properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity. Additionally, it may participate in coordination chemistry due to the nitrogen atoms in the pyridine rings, allowing it to form complexes with metal ions. Overall, dipyridin-3-ylmethanone is a versatile compound with applications in various fields, including organic synthesis and materials science.
Formula:C11H8N2O
InChI:InChI=1/C11H8N2O/c14-11(9-3-1-5-12-7-9)10-4-2-6-13-8-10/h1-8H
InChI key:AQLPDLOXKZRZEV-UHFFFAOYSA-N
SMILES:c1cc(cnc1)C(=O)c1cccnc1
Found 5 products.