CAS 35783-10-9

4,5-Dihydro-1-benzoxepin-3(2H)-one

Description:

4,5-Dihydro-1-benzoxepin-3(2H)-one, with the CAS number 35783-10-9, is a chemical compound characterized by its bicyclic structure, which includes a benzene ring fused to a heterocyclic oxepin moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents. Its molecular structure features a lactone functional group, contributing to its reactivity and potential applications in organic synthesis. The compound may possess biological activity, making it of interest in medicinal chemistry and pharmacology. Additionally, its unique structural features allow for potential interactions with various biological targets, which can be explored for therapeutic purposes. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use. Overall, 4,5-Dihydro-1-benzoxepin-3(2H)-one represents a valuable compound for research and development in various chemical and pharmaceutical applications.

Formula: C₁₀H₁₀O₂

InChI: InChI=1S/C10H10O2/c11-9-6-5-8-3-1-2-4-10(8)12-7-9/h1-4H,5-7H2

InChI key: InChIKey=KKXKJOBVUSXAFR-UHFFFAOYSA-N

SMILES: O=C1CCC=2C(OC1)=CC=CC2

Synonyms:

• 3,4-Dihydro-2H-1-benzoxepin-3-one
• 4,5-Dihydro-1-benzoxepin-3(2H)-one
• 2,3,4,5-Tetrahydro-1-benzoxepin-3-one
• 1-Benzoxepin-3(2H)-one, 4,5-dihydro-

2,3,4,5-Tetrahydro-1-benzoxepin-3-one

CAS: 35783-10-9

2,3,4,5-Tetrahydro-1-benzoxepin-3-one is an acrylamide derivative that has been shown to undergo ring cleavage under certain conditions. The cleavage of the benzene ring leads to the formation of two aromatic rings and a carboxylic acid.

Formula: C₁₀H₁₀O₂

Purity: Min. 95%

Molecular weight: 162.18 g/mol

Ref: 3D-KBA78310