CAS 35808-45-8

pyrido[2,3-b]pyrazin-6(5H)-one

Description:

Pyrido[2,3-b]pyrazin-6(5H)-one is a heterocyclic organic compound characterized by its fused pyridine and pyrazine rings, which contribute to its unique chemical properties. This compound typically exhibits a planar structure, allowing for effective π-π stacking interactions, which can influence its solubility and reactivity. It is often used in medicinal chemistry due to its potential biological activity, including antimicrobial and anticancer properties. The presence of the carbonyl group in the 6-position enhances its reactivity, making it a useful intermediate in organic synthesis. Pyrido[2,3-b]pyrazin-6(5H)-one is generally soluble in polar organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Additionally, its molecular structure allows for various substitution reactions, making it a versatile building block in the development of pharmaceuticals and agrochemicals. As with many heterocycles, it may exhibit fluorescence properties, which can be advantageous in certain analytical applications.

Formula: C₇H₅N₃O

InChI: InChI=1/C7H5N3O/c11-6-2-1-5-7(10-6)9-4-3-8-5/h1-4H,(H,9,10,11)

SMILES: c1cc(nc2c1nccn2)O

Pyrido[2,3-b]pyrazin-6(5H)-one

CAS: 35808-45-8

Formula: C₇H₅N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 147.1341

Ref: IN-DA007F01

Pyrido[2,3-b]pyrazin-6(5H)-one

CAS: 35808-45-8

Pyrido[2,3-b]pyrazin-6(5H)-one

Purity: 98%

Molecular weight: 147.13g/mol

Ref: 54-OR81694

Pyrido[2,3-b]pyrazin-6(5H)-one

CAS: 35808-45-8

Formula: C₇H₅N₃O

Purity: 98%

Molecular weight: 147.137

Ref: 10-F077517