CAS 35808-68-5

4-chloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine

Description:

4-Chloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 4-position and a methyl group at the 6-position enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to brown solid appearance and has a relatively high melting point, indicative of strong intermolecular interactions. It is known for its potential applications in medicinal chemistry, particularly as a scaffold for developing pharmaceuticals due to its biological activity against certain targets. The compound's structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, its stability under standard laboratory conditions makes it suitable for further chemical modifications. As with many heterocycles, it may exhibit interesting electronic properties, which can be explored in the context of material science and drug design.

Formula: C₇H₆ClN₃

InChI: InChI=1/C7H6ClN3/c1-4-2-5-6(8)9-3-10-7(5)11-4/h2-3H,1H3,(H,9,10,11)

SMILES: Cc1cc2c(Cl)ncnc2[nH]1

Synonyms:

• 7H-pyrrolo[2,3-d]pyrimidine, 4-chloro-6-methyl-

4-Chloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine

CAS: 35808-68-5

Formula: C₇H₆ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 167.5956

Ref: IN-DA007F00

4-Chloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine

CAS: 35808-68-5

4-Chloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine

Purity: 97%

Molecular weight: 167.60g/mol

Ref: 54-OR301210

4-Chloro-6-methyl-7H-pyrrolo[2,3-d]pyrimidine

CAS: 35808-68-5

Formula: C₇H₆ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 167.6

Ref: 10-F093650