CAS 35818-31-6
:Cladosporin
Description:
Cladosporin is a natural compound classified as a secondary metabolite produced by certain fungi, particularly those in the genus Cladosporium. It is known for its complex structure, which includes multiple functional groups that contribute to its biological activity. Cladosporin exhibits antimicrobial properties, making it of interest in pharmaceutical research for potential therapeutic applications. The compound has been studied for its ability to inhibit the growth of various pathogens, including bacteria and fungi. Additionally, Cladosporin has shown potential as an anti-inflammatory agent, which further enhances its significance in medicinal chemistry. Its chemical structure features a polycyclic framework, which is characteristic of many natural products, and it may interact with biological targets through various mechanisms, including enzyme inhibition. As research continues, the exploration of Cladosporin's full range of biological activities and its potential applications in drug development remains an area of active investigation.
Formula:C16H20O5
InChI:InChI=1S/C16H20O5/c1-9-3-2-4-12(20-9)8-13-6-10-5-11(17)7-14(18)15(10)16(19)21-13/h5,7,9,12-13,17-18H,2-4,6,8H2,1H3/t9-,12+,13+/m0/s1
InChI key:InChIKey=WOMKDMUZNBFXKG-ZWKOPEQDSA-N
SMILES:O=C1C=2C(C[C@H](C[C@@H]3O[C@@H](C)CCC3)O1)=CC(O)=CC2O
Synonyms:- Asperentin
- 1H-2-Benzopyran-1-one, 3,4-dihydro-6,8-dihydroxy-3-[(tetrahydro-6-methyl-2H-pyran-2-yl)methyl]-, [2R-[2α(R*),6β]]-
- 1H-2-Benzopyran-1-one, 3,4-dihydro-6,8-dihydroxy-3-[[(2R,6S)-tetrahydro-6-methyl-2H-pyran-2-yl]methyl]-, (3R)-
- Cladosporin
- (3R)-3,4-Dihydro-6,8-dihydroxy-3-[[(2R,6S)-tetrahydro-6-methyl-2H-pyran-2-yl]methyl]-1H-2-benzopyran-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cladosporin; Asperentin
CAS:Formula:C16H20O5Purity:100.0%Color and Shape:Brownish. SolidMolecular weight:292.0Cladosporin
CAS:Controlled ProductApplications Cladosporin is an antimalarial drug and an inhibitor of Plasmodium falciparum lysyl-tRNA synthetase.
References Cochrane, R. V. K., et al.: Angew. Chem. Int. Ed. 55, 664 (2016); Novoa, E. M. and Ribas de Pouplana, L.: Chem. Biol. 22, 685 (2015)Formula:C16H20O5Color and Shape:NeatMolecular weight:292.33Cladosporin
CAS:Cladosporin is a secondary metabolite and natural product, specifically a fungal cyclodepsipeptide, which is isolated from the fungus *Cladosporium cladosporioides*. It exhibits its mode of action by selectively inhibiting the lysyl-tRNA synthetase enzyme in the Plasmodium species, the causative agent of malaria. This inhibition disrupts the protein synthesis pathway crucial for the survival and proliferation of the parasite.
Formula:C16H20O5Purity:Min. 95%Molecular weight:292.33 g/molCladosporin
CAS:Cladosporin, from Cladosporium cladosporioid fungus, halts dermatophyte growth on agar at 75 μg/mL.Formula:C16H20O5Color and Shape:SolidMolecular weight:292.33




