CAS 35824-98-7
:5-[(dimethylamino)methylidene]-1,3-dimethylpyrimidine-2,4,6(1H,3H,5H)-trione
Description:
5-[(Dimethylamino)methylidene]-1,3-dimethylpyrimidine-2,4,6(1H,3H,5H)-trione, commonly referred to by its CAS number 35824-98-7, is a synthetic organic compound characterized by its pyrimidine core structure. This compound features a dimethylamino group, which contributes to its basicity and potential reactivity. The presence of multiple carbonyl groups within the pyrimidine ring indicates that it may exhibit tautomeric behavior and participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The dimethyl groups attached to the pyrimidine ring enhance its lipophilicity, potentially influencing its solubility in organic solvents. This compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its structural complexity and functional groups suggest that it could interact with biological macromolecules, leading to various applications in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C9H13N3O3
InChI:InChI=1/C9H13N3O3/c1-10(2)5-6-7(13)11(3)9(15)12(4)8(6)14/h5H,1-4H3
SMILES:CN(C)C=C1C(=O)N(C)C(=O)N(C)C1=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3-Dimethyl-5-[(dimethylamino)methylene]2,4,6-(1H,3H,5H)-trioxopryimidine
CAS:Controlled ProductFormula:C9H13N3O3Color and Shape:NeatMolecular weight:211.22
