CAS 35851-12-8
:2-(2-chloro-6-methylphenoxy)propanoic acid
Description:
2-(2-chloro-6-methylphenoxy)propanoic acid, with the CAS number 35851-12-8, is a chemical compound that belongs to the class of phenoxy herbicides. It features a propanoic acid moiety linked to a phenoxy group, which contains a chlorine atom and a methyl group on the aromatic ring. This compound is characterized by its ability to inhibit specific enzymes involved in plant growth, making it effective as a herbicide. It typically appears as a solid or crystalline substance and is soluble in organic solvents but has limited solubility in water. The presence of the chlorine and methyl substituents on the phenyl ring contributes to its biological activity and stability. Safety data indicates that, like many herbicides, it should be handled with care, as it may pose risks to non-target organisms and the environment. Proper storage and disposal practices are essential to mitigate any potential hazards associated with its use.
Formula:C10H11ClO3
InChI:InChI=1/C10H11ClO3/c1-6-4-3-5-8(11)9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13)
SMILES:Cc1cccc(c1OC(C)C(=O)O)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
