CAS 35852-58-5
:3-chloro-4-hydroxybenzotrifluoride
Description:
3-Chloro-4-hydroxybenzotrifluoride, with the CAS number 35852-58-5, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom, a hydroxyl group, and three fluorine atoms. This compound typically appears as a colorless to pale yellow liquid and is known for its relatively high stability and low volatility. The presence of the hydroxyl group imparts some polar characteristics, while the trifluoromethyl groups enhance its lipophilicity and can influence its reactivity and solubility in various solvents. It is often utilized in chemical synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, due to the presence of chlorine and fluorine, it may exhibit unique properties such as increased resistance to degradation and specific interactions with biological systems. Safety data sheets should be consulted for handling and storage guidelines, as it may pose health and environmental risks.
Formula:C7H4ClF3O
InChI:InChI=1/C7H4ClF3O/c8-5-3-4(7(9,10)11)1-2-6(5)12/h1-3,12H
SMILES:c1cc(c(cc1C(F)(F)F)Cl)O
Synonyms:- 2-Chloro-4-trifluoromethylphenol
- 2,8-bis(trifluoromethyl)quinolin-4(1H)-one
- 2-Chloro-4-(Trifluoromethyl)Phenol
- 2-Chloro-4-Trifluoromethylphenl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Chloro-4-(trifluoromethyl)phenol
CAS:Formula:C7H4ClF3OPurity:>98.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:196.553-Chloro-4-hydroxybenzotrifluoride
CAS:Formula:C7H4ClF3OPurity:97%Color and Shape:LiquidMolecular weight:196.55433-Chloro-4-hydroxybenzotrifluoride
CAS:3-Chloro-4-hydroxybenzotrifluorideFormula:C7H4ClF3OPurity:98%Color and Shape: clear liquidMolecular weight:196.55g/mol3-Chloro-4-hydroxybenzotrifluoride
CAS:Formula:C7H4ClF3OPurity:97%Color and Shape:ClearMolecular weight:196.552-Chloro-4-(trifluoromethyl)phenol
CAS:<p>2-Chloro-4-(trifluoromethyl)phenol is a synthetic chemical that is used as an oxidant. It is synthesized by the reaction of an alkali metal, such as potassium or sodium, with diphenyl ether. 2-Chloro-4-(trifluoromethyl)phenol can be used to remove organic contaminants from wastewater. The reaction time for 2-chloro-4-(trifluoromethyl)phenol depends on the type of contaminant being oxidized and the amount of oxidant present. For example, inorganic contaminants are typically more difficult to oxidize than organic contaminants and require a longer reaction time. The product may be filtered afterwards to remove any solid materials. High-performance liquid chromatography (HPLC) can be used to determine the concentration of 2-chloro-4-(trifluoromethyl)phenol in solution.</p>Formula:C7H4ClF3OPurity:Min. 98 Area-%Color and Shape:Clear LiquidMolecular weight:196.55 g/mol




