CAS 35853-50-0
:2,8-bis(trifluoromethyl)quinoline-4-carboxylic acid
Description:
2,8-bis(trifluoromethyl)quinoline-4-carboxylic acid is a synthetic organic compound characterized by its quinoline structure, which features a bicyclic aromatic system. The presence of two trifluoromethyl groups at the 2 and 8 positions significantly enhances its lipophilicity and alters its electronic properties, making it a valuable compound in various chemical applications. The carboxylic acid functional group at the 4 position contributes to its acidity and potential for forming hydrogen bonds, which can influence its solubility and reactivity. This compound is often studied for its potential use in pharmaceuticals, agrochemicals, and materials science due to its unique structural features. Additionally, the trifluoromethyl groups can impart desirable characteristics such as increased metabolic stability and improved binding affinity in biological systems. Overall, 2,8-bis(trifluoromethyl)quinoline-4-carboxylic acid is a versatile compound with significant implications in research and development across multiple fields.
Formula:C12H5F6NO2
InChI:InChI=1/C12H5F6NO2/c13-11(14,15)7-3-1-2-5-6(10(20)21)4-8(12(16,17)18)19-9(5)7/h1-4H,(H,20,21)
SMILES:c1cc2c(cc(C(F)(F)F)nc2c(c1)C(F)(F)F)C(=O)O
Synonyms:- 4-Quinolinecarboxylic Acid, 2,8-Bis(Trifluoromethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,8-Bis-(trifluoromethyl)-4-quinolinecarboxylic Acid
CAS:Controlled ProductFormula:C12H5F6NO2Color and Shape:NeatMolecular weight:309.16Carboxymefloquine
CAS:Controlled ProductFormula:C12H5F6NO2Color and Shape:NeatMolecular weight:309.16Carboxymefloquine
CAS:Carboxymefloquine is a cytochrome P450 inhibitor that is used as an antiparasitic drug in the treatment of intestinal amebiasis and malaria. Carboxymefloquine inhibits the activity of various cytochrome P450 enzymes, which are involved in the metabolism of other drugs. Carboxymefloquine has been shown to decrease the elimination rate of quinidine and propranolol, which may lead to increased concentrations of these drugs in plasma. Carboxymefloquine also has a long terminal half-life and may cause drug interactions with other drugs that are metabolized by cytochrome P450 enzymes. Clinical studies have shown that carboxymefloquine can be used for the treatment of inflammatory bowel disease (IBD). The clinical relevance of this drug is not fully understood because it does not inhibit prostaglandin synthesis or induce apoptosis in intestinal epithelial cells, unlike other IBD treatments such asFormula:C12H5F6NO2Purity:Min. 95 Area-%Color and Shape:Orange PowderMolecular weight:309.17 g/molCarboxymefloquine-d3
CAS:Controlled ProductApplications Labelled Carboxymefloquine (C178700). Carboxymefloquine is a metabolite of Mefloquine (M207050).
References Crevoisier, C., et al.: Eur. J. Clin. Pharmacol., 53, 135 (1997), Ridtitid, W., et al.: J. Pharm. Pharmacol., 52, 1265 (2000),Formula:C12H2D3F6NO2Color and Shape:NeatMolecular weight:312.18



