CAS 35856-62-3
:piperidine-1-sulfonyl chloride
Description:
Piperidine-1-sulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group attached to a piperidine ring. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. This compound is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can undergo nucleophilic substitution reactions. It is often used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. Piperidine-1-sulfonyl chloride is soluble in polar organic solvents, and it should be handled with care due to its corrosive nature and potential to release harmful gases upon reaction with water or moisture. Safety precautions, including the use of personal protective equipment, are essential when working with this compound. Its applications extend to medicinal chemistry and the development of pharmaceuticals, where it serves as an important building block in the synthesis of various bioactive molecules.
Formula:C5H10ClNO2S
InChI:InChI=1/C5H10ClNO2S/c6-10(8,9)7-4-2-1-3-5-7/h1-5H2
SMILES:C1CCN(CC1)S(=O)(=O)Cl
Synonyms:- 1-Piperidinesulfonyl chloride
- Piperadine-1-sulfonylchloride
- Piperidinosulfonyl chloride
- piperidine-1-sulfonyl chloride(SALTDATA: FREE)
- N-piperidinylsulfaMoyl chloride
- Piperidine-1-sulfonyl chloride 96%
- Piperidinesulfonyl chloride
- 1-Piperidinesulfonylchloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Piperidine-1-sulfonyl chloride, 97%
CAS:Piperidine-1-sulfonyl chloride is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reFormula:C5H10ClNO2SPurity:97%Molecular weight:183.65Piperidine-1-sulfonyl chloride
CAS:Formula:C5H10ClNO2SPurity:97%Color and Shape:LiquidMolecular weight:183.6564Piperidine-1-sulfonyl chloride
CAS:Piperidine-1-sulfonyl chlorideFormula:C5H10ClNO2SPurity:95%Color and Shape: dark brown liquidMolecular weight:183.66g/molPiperidine-1-sulfonyl chloride
CAS:Formula:C5H10ClNO2SPurity:97%Color and Shape:LiquidMolecular weight:183.65Piperidine-1-sulfonyl chloride
CAS:Piperidine-1-sulfonyl chloride (PSC) is a compound that has been found to have neuroprotective properties. PSC inhibits the production of nitric oxide and peroxynitrite, which are reactive oxygen species (ROS) that damage cells and DNA. PSC also prevents the formation of ROS by inhibiting the activation of protein kinase C and phospholipase A2. The neuroprotective effects of PSC may be due to its ability to inhibit matrix metalloproteinases, which are enzymes that break down tissue in response to injury or disease. This drug has also been shown to have high cytotoxicity against cancer cell lines in vitro. Piperidine-1-sulfonyl chloride is a chemical compound with neuroprotective properties. It inhibits the production of nitric oxide and peroxynitrite, which are reactive oxygen species (ROS) that damage cells and DNA. PSC also prevents the formationFormula:C5H10ClNO2SPurity:Min. 95%Molecular weight:183.66 g/mol




