CAS 35857-89-7

6-chloropyridazine-3-carbonitrile

Description:

6-Chloropyridazine-3-carbonitrile is a heterocyclic organic compound characterized by a pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 2. The presence of a chlorine atom at the 6-position and a cyano group (-C≡N) at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure allows for potential reactivity in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it of interest in synthetic organic chemistry. Additionally, the presence of the cyano group can enhance its utility in the synthesis of other compounds, as it can serve as a versatile functional group. 6-Chloropyridazine-3-carbonitrile may also possess biological activity, making it a candidate for research in pharmaceuticals or agrochemicals. As with many nitrogen-containing heterocycles, it may exhibit interesting electronic properties, influencing its behavior in chemical reactions and interactions with other molecules.

Formula: C₅H₂ClN₃

InChI: InChI=1/C5H2ClN3/c6-5-2-1-4(3-7)8-9-5/h1-2H

SMILES: c1cc(Cl)nnc1C#N

Synonyms:

• 3-Pyridazinecarbonitrile, 6-chloro-

6-Chloropyridazine-3-carbonitrile

CAS: 35857-89-7

Formula: C₅H₂ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 139.5425

Ref: IN-DA003J9V

6-Chloro-3-pyridazinecarbonitrile

CAS: 35857-89-7

6-Chloro-3-pyridazinecarbonitrile

Purity: 95%

Color and Shape: Solid

Molecular weight: 139.54g/mol

Ref: 54-OR951394

6-Chloropyridazine-3-carbonitrile

CAS: 35857-89-7

Formula: C₅H₂ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 139.54

Ref: 10-F068762