CAS 358681-61-5: (2S,3R,4S,5S,6S)-5-benzyloxy-2-(benzyloxymethyl)-6-[(2S,3R,4S,5S,6S)-4,5-dibenzyloxy-2-(benzyloxymethyl)-6-(4-methoxyphenoxy)tetrahydropyran-3-yl]oxy-tetrahydropyran-3,4-diol
Description:The chemical substance with the name "(2S,3R,4S,5S,6S)-5-benzyloxy-2-(benzyloxymethyl)-6-[(2S,3R,4S,5S,6S)-4,5-dibenzyloxy-2-(benzyloxymethyl)-6-(4-methoxyphenoxy)tetrahydropyran-3-yl]oxy-tetrahydropyran-3,4-diol" and CAS number "358681-61-5" is a complex organic compound characterized by multiple stereocenters, indicating its chiral nature. This compound features a tetrahydropyran backbone, which is a six-membered cyclic ether, and is substituted with various benzyloxy and methoxyphenoxy groups, contributing to its structural complexity and potential biological activity. The presence of multiple hydroxyl groups suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. Such compounds are often of interest in medicinal chemistry due to their potential as drug candidates or intermediates in the synthesis of more complex molecules. The specific stereochemistry (2S,3R,4S,5S,6S) indicates the spatial arrangement of atoms, which is crucial for determining the compound's interactions with biological targets. Overall, this substance exemplifies the intricate nature of organic molecules used in pharmaceutical applications.
Formula:C54H58O12
InChI:InChI=1/C54H58O12/c1-57-43-27-29-44(30-28-43)63-54-52(62-35-42-25-15-6-16-26-42)51(61-34-41-23-13-5-14-24-41)49(46(65-54)37-59-32-39-19-9-3-10-20-39)66-53-50(60-33-40-21-11-4-12-22-40)48(56)47(55)45(64-53)36-58-31-38-17-7-2-8-18-38/h2-30,45-56H,31-37H2,1H3/t45-,46-,47-,48-,49+,50-,51-,52-,53-,54+/m0/s1