CAS 358731-94-9: Stannane, chlorotri(phenyl-d5)-

Description:Stannane, chlorotri(phenyl-d5)-, also known as tri(phenyl-d5)chlorostannane, is an organotin compound characterized by the presence of a tin atom bonded to three deuterated phenyl groups and one chlorine atom. The deuterated phenyl groups (phenyl-d5) indicate that the hydrogen atoms in the phenyl rings are replaced with deuterium, a heavier isotope of hydrogen, which can be useful in various applications, including NMR spectroscopy and tracing studies. This compound typically exhibits properties associated with organotin compounds, such as moderate stability and potential reactivity due to the presence of the chlorine atom. Organotin compounds are known for their applications in organic synthesis, catalysis, and as intermediates in the production of other chemical substances. However, they can also pose environmental and health risks, leading to regulatory scrutiny. The specific characteristics, such as solubility, melting point, and reactivity, would depend on the molecular structure and the nature of the substituents attached to the tin atom.

Formula:C₁₈ClD₁₅Sn

InChI:InChI=1S/3C6H5.ClH.Sn/c3*1-2-4-6-5-3-1;;/h3*1-5H;1H;/q;;;;+1/p-1/i3*1D,2D,3D,4D,5D;;

InChI key:InChIKey=NJVOZLGKTAPUTQ-NLOSMHEESA-M

SMILES:Cl[Sn](C=1C=CC=CC1)(C=2C=CC=CC2)C=3C=CC=CC3

Synonyms:
Stannane, chlorotri(phenyl-d5)-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Triphenyl-d15-tin Chloride REF: 3U-D5565CAS: 358731-94-9 639-58-7	99 atom % D	335.00 €~549.00 €	Mon 21 Apr 25
Deuterated Organotin Mixture 676 100 µg/mL in Methanol REF: 04-A50000676MECAS: 1257647-76-9 358731-92-7 358731-94-9	- - -	To inquire	Tue 22 Apr 25
Chlorotriphenylstannane-d15 REF: TR-C422252CAS: 358731-94-9	- - -	383.00 €~2,479.00 €	Tue 29 Apr 25