CAS 358731-94-9

Stannane, chlorotri(phenyl-d5)-

Description:

Stannane, chlorotri(phenyl-d5)-, also known as tri(phenyl-d5)chlorostannane, is an organotin compound characterized by the presence of a tin atom bonded to three deuterated phenyl groups and one chlorine atom. The deuterated phenyl groups (phenyl-d5) indicate that the hydrogen atoms in the phenyl rings are replaced with deuterium, a heavier isotope of hydrogen, which can be useful in various applications, including NMR spectroscopy and tracing studies. This compound typically exhibits properties associated with organotin compounds, such as moderate stability and potential reactivity due to the presence of the chlorine atom. Organotin compounds are known for their applications in organic synthesis, catalysis, and as intermediates in the production of other chemical substances. However, they can also pose environmental and health risks, leading to regulatory scrutiny. The specific characteristics, such as solubility, melting point, and reactivity, would depend on the molecular structure and the nature of the substituents attached to the tin atom.

Formula: C₁₈ClD₁₅Sn

InChI: InChI=1S/3C6H5.ClH.Sn/c3*1-2-4-6-5-3-1;;/h3*1-5H;1H;/q;;;;+1/p-1/i3*1D,2D,3D,4D,5D;;

InChI key: InChIKey=NJVOZLGKTAPUTQ-NLOSMHEESA-M

SMILES: [Sn](Cl)(C1=C(C(=C(C(=C1[2H])[2H])[2H])[2H])[2H])(C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])C3=C(C(=C(C(=C3[2H])[2H])[2H])[2H])[2H]

Synonyms:

• Stannane, chlorotri(phenyl-d5)-

Triphenyl-d15-tin Chloride

CAS: 358731-94-9, 639-58-7

Formula: (C₆D₅)₃SnCl

Purity: 99 atom % D

Color and Shape: White Solid

Molecular weight: 401.08258

Ref: 3U-D5565

Deuterated Organotin Mixture 676 100 µg/mL in Methanol

Controlled Product

CAS: 1257647-76-9, 358731-92-7, 358731-94-9

Color and Shape: Mixture

Ref: 04-A50000676ME

Chlorotriphenylstannane-d15

Controlled Product

CAS: 358731-94-9

Applications Labeled Chlorotriphenylstannane, which is used in the synthesis of nanoparticles which bear triamide ligands.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Shariatinia, Z. et al.: Beil. J. Nanotech., 4, 94 (2013);

Formula: C₁₈D₁₅ClSn

Color and Shape: White To Off-White

Molecular weight: 400.57

Ref: TR-C422252