CAS 358731-95-0

Benzene-1,2,3-d3, 4,6-dichloro-5-methyl-

Description:

Benzene-1,2,3-d3, 4,6-dichloro-5-methyl- is a chlorinated aromatic compound characterized by its benzene ring structure, which is substituted with multiple functional groups. The presence of deuterium (d3) indicates that three hydrogen atoms in the benzene ring have been replaced with deuterium isotopes, enhancing its stability and altering its physical properties. The dichloro substitutions at the 4 and 6 positions introduce chlorine atoms, which can significantly influence the compound's reactivity and polarity. Additionally, the methyl group at the 5 position contributes to the overall hydrophobic character of the molecule. This compound is likely to exhibit unique chemical behavior due to the combination of halogenation and isotopic labeling, making it useful in various applications, including research in organic chemistry and environmental studies. Its specific properties, such as boiling point, melting point, and solubility, would depend on the interactions between the substituents and the benzene core, as well as the presence of deuterium.

Formula: C₇H₃Cl₂D₃

InChI: InChI=1S/C7H6Cl2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3/i2D,3D,4D

InChI key: InChIKey=DMEDNTFWIHCBRK-NRUYWUNFSA-N

SMILES: CC1=C(Cl)C(=C(C(=C1Cl)[2H])[2H])[2H]

Synonyms:

• 2,6-Dichlorotoluene-3,4,5-D3
• Benzene-1,2,3-d₃, 4,6-dichloro-5-methyl-
• Benzene-1,2,3-d3, 4,6-dichloro-5-methyl-

2,6-Dichlorotoluene-3,4,5-d3

CAS: 358731-95-0

Formula: Cl₂C₆D₃CH₃

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 163.00349

Ref: 3U-D5567

2,6-Dichlorotoluene-3,4,5-d3

Controlled Product

CAS: 358731-95-0

Formula: C₇H₃D₃Cl₂

Color and Shape: Neat

Molecular weight: 164.04

Ref: TR-D435351