CymitQuimica logo

CAS 358789-72-7

:

4-[(1-methylpiperidin-4-yl)oxy]aniline

Description:
4-[(1-Methylpiperidin-4-yl)oxy]aniline, identified by its CAS number 358789-72-7, is an organic compound characterized by the presence of an aniline moiety substituted with a piperidine-derived ether group. This compound features a piperidine ring that is methylated at the nitrogen atom, enhancing its basicity and potentially influencing its solubility and reactivity. The aniline portion contributes to its potential as a nucleophile in various chemical reactions, while the ether linkage may affect its steric and electronic properties. Typically, compounds of this nature are studied for their biological activity, particularly in medicinal chemistry, where they may serve as intermediates or active pharmaceutical ingredients. The presence of both the aromatic amine and the piperidine ring suggests potential interactions with biological targets, making it of interest in drug development. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by its molecular structure and functional groups, which are critical for understanding its behavior in different environments.
Formula:C12H18N2O
InChI:InChI=1/C12H18N2O/c1-14-8-6-12(7-9-14)15-11-4-2-10(13)3-5-11/h2-5,12H,6-9,13H2,1H3
InChI key:CIVRCZPEYZHQDI-UHFFFAOYSA-N
SMILES:CN1CCC(CC1)Oc1ccc(cc1)N
Synonyms:
  • Benzenamine, 4-[(1-Methyl-4-Piperidinyl)Oxy]-
Found 3 products.