CAS 3588-18-9
:(Z)-2,6-dimethylocta-5,7-dien-4-one
Description:
(Z)-2,6-dimethylocta-5,7-dien-4-one, with the CAS number 3588-18-9, is an organic compound characterized by its unique structure featuring a ketone functional group and two double bonds in a specific geometric configuration. This compound belongs to the class of unsaturated ketones and is notable for its (Z) configuration, indicating that the highest priority substituents on the double bonds are on the same side. It typically exhibits a yellow to amber color and has a distinct odor, which can be reminiscent of certain natural fragrances. The presence of multiple double bonds contributes to its reactivity, making it susceptible to addition reactions. This compound is often studied for its potential applications in organic synthesis and as a flavoring or fragrance agent due to its appealing aromatic properties. Additionally, its structural features may allow it to participate in various chemical reactions, including polymerization and oxidation, making it of interest in both industrial and research settings.
Formula:C10H16O
InChI:InChI=1/C10H16O/c1-5-9(4)7-10(11)6-8(2)3/h5,7-8H,1,6H2,2-4H3/b9-7-
InChI key:InChIKey=RJXKHBTYHGBOKV-CLFYSBASSA-N
SMILES:C(/C=C(\C=C)/C)(CC(C)C)=O
Synonyms:- (5E)-2,6-dimethylocta-5,7-dien-4-one
- (5Z)-2,6-Dimethyl-5,7-octadien-4-one
- (5Z)-2,6-dimethylocta-5,7-dien-4-one
- (Z)-5,7-Octadine-4-one-2,6-dimethyl
- (Z)-Tagetone
- 5,7-Octadien-4-one, 2,6-dimethyl-, (5Z)-
- 5,7-Octadien-4-one, 2,6-dimethyl-, (Z)-
- cis-Tagetone
- (Z)-2,6-Dimethylocta-5,7-dien-4-one
- Einecs 222-725-3
- (Z)-2,6-Dimethyl-5,7-octadien-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
