CAS 3589-41-1
:N-(benzyloxycarbonyl)-2-aminoacetonitrile
Description:
N-(Benzyloxycarbonyl)-2-aminoacetonitrile, with the CAS number 3589-41-1, is an organic compound characterized by its functional groups and structural features. It contains an amino group (-NH2), a nitrile group (-C≡N), and a benzyloxycarbonyl (Z) protecting group, which is commonly used in peptide synthesis to protect the amino group during chemical reactions. This compound is typically a white to off-white solid and is soluble in polar organic solvents. Its molecular structure allows it to participate in various chemical reactions, making it valuable in organic synthesis, particularly in the preparation of amino acids and peptides. The presence of the nitrile group contributes to its reactivity, enabling transformations such as hydrolysis or reduction. Additionally, the benzyloxycarbonyl group can be removed under specific conditions, allowing for the deprotection of the amino group for further functionalization. Overall, N-(benzyloxycarbonyl)-2-aminoacetonitrile is an important intermediate in synthetic organic chemistry, particularly in the field of medicinal chemistry and drug development.
Formula:C10H10N2O2
InChI:InChI=1/C10H10N2O2/c11-6-7-12-10(13)14-8-9-4-2-1-3-5-9/h1-5H,7-8H2,(H,12,13)
SMILES:c1ccc(cc1)COC(=NCC#N)O
Synonyms:- N-Carbobenzoxyaminoacetonitrile
- Benzyl (Cyanomethyl)Carbamate
- N-Cbz-aminoacetonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
N-(Benzyloxycarbonyl)aminoacetonitrile
CAS:Formula:C10H10N2O2Purity:>95.0%(N)Color and Shape:White to Light yellow powder to crystalMolecular weight:190.20Benzyl (cyanomethyl)carbamate
CAS:Formula:C10H10N2O2Purity:97%Color and Shape:SolidMolecular weight:190.1986N-Carbobenzoxyaminoacetonitrile
CAS:N-CarbobenzoxyaminoacetonitrilePurity:98%Molecular weight:190.20g/molBenzyl Cyanomethylcarbamate
CAS:Controlled Product<p>Applications BENZYL CYANOMETHYLCARBAMATE (cas# 3589-41-1) is a useful research chemical.<br></p>Formula:C10H10N2O2Color and Shape:NeatMolecular weight:190.19N-(Benzyloxycarbonyl)-2-aminoacetonitrile
CAS:N-(Benzyloxycarbonyl)-2-aminoacetonitrile is a chemists molecule that has significant cytotoxicity. It is used as an antibacterial agent against Streptococcus pneumoniae, which is the cause of bacterial pneumonia and ear infections. The drug binds to the fatty acid biosynthesis enzyme, inhibiting the production of long-chain fatty acids such as palmitic and oleic acids. This leads to cell death through apoptosis or necrosis. N-(Benzyloxycarbonyl)-2-aminoacetonitrile has potent antibacterial activity against S. pneumoniae and other bacteria that are resistant to penicillin, ampicillin, erythromycin, and tetracycline antibiotics.Formula:C10H10N2O2Purity:Min. 95%Molecular weight:190.2 g/mol





