CymitQuimica logo

CAS 3589-45-5

:

3-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)propanenitrile

Description:
3-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)propanenitrile, with the CAS number 3589-45-5, is a chemical compound that features a complex structure characterized by the presence of an isoindole moiety and a nitrile functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The dioxo group suggests the presence of carbonyl functionalities, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The nitrile group (-C≡N) is known for its ability to act as a versatile building block in organic synthesis, often serving as a precursor to amines or carboxylic acids upon hydrolysis. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvent used. Overall, this compound represents a valuable structure for further exploration in synthetic and medicinal chemistry.
Formula:C11H8N2O2
InChI:InChI=1/C11H8N2O2/c12-6-3-7-13-10(14)8-4-1-2-5-9(8)11(13)15/h1-2,4-5H,3,7H2
InChI key:LOOWMCWVRNEZLZ-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)C(=O)N(CCC#N)C2=O
Synonyms:
  • 2H-isoindole-2-propanenitrile, 1,3-dihydro-1,3-dioxo-
  • N-(2-Cyanoethyl)phthalimide
Found 3 products.