CAS 35897-92-8: methyl (3Z)-3-ethylidene-2-(beta-D-glucopyranosyloxy)-4-{2-[2-(4-hydroxyphenyl)ethoxy]-2-oxoethyl}-3,4-dihydro-2H-pyran-5-carboxylate
Description:Methyl (3Z)-3-ethylidene-2-(beta-D-glucopyranosyloxy)-4-{2-[2-(4-hydroxyphenyl)ethoxy]-2-oxoethyl}-3,4-dihydro-2H-pyran-5-carboxylate, with CAS number 35897-92-8, is a complex organic compound characterized by its intricate molecular structure, which includes a pyran ring, a glucopyranosyl moiety, and various functional groups such as esters and ethers. This compound exhibits properties typical of glycosides, including potential solubility in polar solvents due to the presence of the glucopyranosyl group. Its structure suggests that it may possess biological activity, possibly acting as a natural product or a synthetic derivative with applications in pharmaceuticals or biochemistry. The presence of the hydroxyphenyl group may contribute to antioxidant properties, while the ethylidene and oxoethyl substituents could influence its reactivity and interaction with biological targets. Overall, this compound represents a fascinating example of the diversity found in organic chemistry, particularly in the realm of glycosides and their derivatives.
Formula:C25H32O12
InChI:InChI=1S/C25H32O12/c1-3-15-16(10-19(28)34-9-8-13-4-6-14(27)7-5-13)17(23(32)33-2)12-35-24(15)37-25-22(31)21(30)20(29)18(11-26)36-25/h3-7,12,16,18,20-22,24-27,29-31H,8-11H2,1-2H3/b15-3+/t16-,18+,20+,21-,22+,24-,25-/m0/s1
InChI key:InChIKey=GMQXOLRKJQWPNB-MVVLSVRYSA-N
SMILES:O=C(OC)C1=COC(OC2OC(CO)C(O)C(O)C2O)C(=CC)C1CC(=O)OCCC3=CC=C(O)C=C3
![methyl (3Z)-3-ethylidene-2-(beta-D-glucopyranosyloxy)-4-{2-[2-(4-hydroxyphenyl)ethoxy]-2-oxoethyl}…](https://static.cymitquimica.com/cas-image/349587-methyl-3z-3-ethylidene-2-beta-d-glucopyranosyloxy-4-2-2-4-hydroxyphenyl-ethoxy-2-oxoethyl-34-dihydro-2h-pyran-5-carboxylate.png)
