
CAS 35898-30-7
:Thymidine, 3′,5′-dibenzoate
Description:
Thymidine, 3′,5′-dibenzoate is a chemical compound derived from thymidine, a nucleoside that plays a crucial role in DNA synthesis. This compound features two benzoate groups esterified at the 3' and 5' hydroxyl positions of the thymidine molecule, which enhances its lipophilicity and may influence its biological activity. The presence of these benzoate groups can affect the compound's solubility, stability, and interaction with biological systems. Thymidine itself is composed of a deoxyribose sugar and a thymine base, and its derivatives are often studied for their potential applications in biochemistry and medicinal chemistry, particularly in the context of nucleic acid research and drug development. The CAS number 35898-30-7 uniquely identifies this specific compound, facilitating its recognition in scientific literature and databases. Overall, thymidine, 3′,5′-dibenzoate exemplifies the structural modifications that can be made to nucleosides to explore their functional properties and therapeutic potential.
Formula:C24H22N2O7
InChI:InChI=1S/C24H22N2O7/c1-15-13-26(24(30)25-21(15)27)20-12-18(33-23(29)17-10-6-3-7-11-17)19(32-20)14-31-22(28)16-8-4-2-5-9-16/h2-11,13,18-20H,12,14H2,1H3,(H,25,27,30)/t18-,19+,20+/m0/s1
InChI key:InChIKey=SNKWLBSAKXIYKF-XUVXKRRUSA-N
SMILES:O=C1N([C@H]2C[C@H](OC(=O)C3=CC=CC=C3)[C@@H](COC(=O)C4=CC=CC=C4)O2)C=C(C)C(=O)N1
Synonyms:- 3′,5′-Bis-O-(phenylcarbonyl)thymidine
- 3′,5′-Dibenzoylthymidine
- Thymidine, 3′,5′-dibenzoate
- 3′,5′-Di-O-benzoylthymidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3',5'-di-O-benzoyl thymidine
CAS:3',5'-di-O-benzoyl thymidine is a Nucleoside Derivative - Other modified nucleoside.Formula:C24H22N2O7Color and Shape:SolidMolecular weight:450.44Ref: TM-TNU1396
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire
