CAS 359-05-7
:Acetonitrile, chlorofluoro-
Description:
Acetonitrile, chlorofluoro- (CAS number 359-05-7) is a chemical compound characterized by its molecular structure, which includes both acetonitrile and chlorofluorinated groups. It is a colorless liquid with a faint, sweet odor, and is known for its polar aprotic nature, making it a useful solvent in various chemical reactions, particularly in organic synthesis and extraction processes. The presence of chlorine and fluorine atoms in its structure contributes to its unique properties, such as increased stability and lower volatility compared to non-halogenated solvents. Acetonitrile, chlorofluoro- is also recognized for its relatively low toxicity, although appropriate safety measures should be taken when handling it, as it can be harmful if inhaled or ingested. Additionally, it has applications in the production of pharmaceuticals, agrochemicals, and as an intermediate in chemical synthesis. Its environmental impact should be considered, as halogenated compounds can pose risks to both human health and ecosystems.
Formula:C2HClFN
InChI:InChI=1S/C2HClFN/c3-2(4)1-5/h2H
InChI key:InChIKey=UJXQQYGDYCLXGP-UHFFFAOYSA-N
SMILES:C(C#N)(Cl)F
Synonyms:- Acetonitrile, chlorofluoro-
- 2-Chloro-2-fluoroacetonitrile
- Chlorofluoroacetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
