CAS 359-25-1
:bromo(fluoro)acetic acid
Description:
Bromo(fluoro)acetic acid, with the CAS number 359-25-1, is a halogenated carboxylic acid characterized by the presence of both bromine and fluorine substituents on the acetic acid backbone. This compound typically appears as a colorless to pale yellow liquid and is known for its strong acidic properties, which are enhanced by the electronegative halogen atoms. The presence of these halogens can significantly influence the compound's reactivity, making it a useful intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Bromo(fluoro)acetic acid is also notable for its potential as a reagent in various chemical reactions, including nucleophilic substitutions and coupling reactions. However, due to the presence of halogens, it may pose environmental and health risks, necessitating careful handling and disposal. Its physical properties, such as boiling point and solubility, are influenced by the halogen substituents, which can affect its behavior in different chemical environments.
Formula:C2H2BrFO2
InChI:InChI=1/C2H2BrFO2/c3-1(4)2(5)6/h1H,(H,5,6)
SMILES:C(C(=O)O)(Br)F
Synonyms:- Acetic acid, 2-bromo-2-fluoro-
- Bromo(fluoro)acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Bromofluoroacetic acid
CAS:Bromofluoroacetic acidFormula:C2H2BrFO2Purity:97%Color and Shape: solidMolecular weight:156.94g/molBromofluoroacetic Acid
CAS:Bromofluoroacetic acid is a synthetic, chiral molecule with the chemical formula CF3CO2H. It has the molecular weight of 109.07 and a boiling point of 212 °C. Bromofluoroacetic acid is used in industry as an intermediate for fluoroacetic acid. It is also used to manufacture bromofluorocarbons, which are used as propellants in aerosol sprays. Bromofluoroacetic acid has been studied in clinical studies as a treatment for epilepsy and as an antimicrobial agent against bacteria such as Staphylococcus aureus and Enterobacter aerogenes.Formula:C2H2BrFO2Purity:Min. 95%Molecular weight:156.94 g/mol

