CAS 359-58-0
:1-chloro-1,1,2,3,3,3-hexafluoropropane
Description:
1-Chloro-1,1,2,3,3,3-hexafluoropropane, with the CAS number 359-58-0, is a halogenated hydrocarbon characterized by its unique molecular structure, which includes one chlorine atom and six fluorine atoms attached to a propane backbone. This compound is a colorless gas or liquid at room temperature, depending on the pressure, and is known for its low boiling point and high density compared to air. It is non-flammable and has a relatively low toxicity profile, making it suitable for various applications, including as a refrigerant and in the production of specialty chemicals. The presence of multiple fluorine atoms contributes to its stability and resistance to degradation, while the chlorine atom enhances its reactivity in certain chemical processes. Additionally, 1-chloro-1,1,2,3,3,3-hexafluoropropane has been studied for its potential environmental impact, particularly concerning ozone depletion and greenhouse gas effects, leading to regulatory scrutiny in some regions.
Formula:C3HClF6
InChI:InChI=1/C3HClF6/c4-2(6,7)1(5)3(8,9)10/h1H
SMILES:C(C(Cl)(F)F)(C(F)(F)F)F
Synonyms:- Propane, 1-Chloro-1,1,2,3,3,3-Hexafluoro-
- 1-Chloro-1,1,2,3,3,3-hexafluoropropane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-Chloro-1,1,2,3,3,3-Hexafluoropropane
CAS:Controlled Product<p>1-Chloro-1,1,2,3,3,3-Hexafluoropropane (CFC-114) is a hydrofluorocarbon that is used in refrigeration and air conditioning. It is a colorless liquid with a sweet odor. CFC-114 has been found to be environmentally friendly as it does not deplete the ozone layer and has low global warming potential. The chemical properties of CFC-114 are constant over long periods of time and at different temperatures. This property can be measured using calorimetry and thermodynamics and can be calculated by parameters such as liquid phase and efficiency.</p>Formula:C3HClF6Purity:Min. 95%Molecular weight:186.48 g/mol
