CAS 359-85-3

4H-1,2,4-Benzothiadiazine, 1,1-dioxide

Description:

4H-1,2,4-Benzothiadiazine, 1,1-dioxide, commonly known as benzothiadiazine dioxide, is a heterocyclic compound characterized by its bicyclic structure that includes a benzene ring fused to a thiadiazine ring. This compound is typically a white to pale yellow crystalline solid and is known for its stability under standard conditions. It is soluble in polar solvents such as water and alcohols, which enhances its utility in various applications. The presence of the sulfonyl group (S=O) contributes to its chemical reactivity, making it a potential candidate for various chemical transformations. Benzothiadiazine derivatives are often studied for their biological activities, including potential use as pharmaceuticals, particularly in the field of diuretics and antihypertensives. The compound's unique structure allows for interactions with biological targets, which can lead to diverse pharmacological effects. Safety data indicates that it should be handled with care, as with many chemical substances, due to potential toxicity and environmental impact.

Formula: C₇H₆N₂O₂S

InChI: InChI=1S/C7H6N2O2S/c10-12(11)7-4-2-1-3-6(7)8-5-9-12/h1-5H,(H,8,9)

InChI key: InChIKey=BBNGVMNBBLPZIR-UHFFFAOYSA-N

SMILES: O=S1(=O)C=2C(=CC=CC2)NC=N1

Synonyms:

• 2H-1,2,4-Benzothiadiazine 1,1-dioxide
• 2H-1λ6,2,4-Benzothiadiazine-1,1-dione
• 2H-Benzo[e][1,2,4]thiadiazine-1,1-dioxide
• 4H-1,2,4-Benzothiadiazine, 1,1-dioxide
• 4H-1,2,4-Benzothiadiazine 1,1-dioxide
• 4H-1,2,4-benzothiadiazine, 1,1-dioxide
• 2H-1,2,4-benzothiadiazine-1,1-dione
• 4H-Benzo[e][1,2,4]thiadiazine 1,1-dioxide

4H-Benzo[e][1,2,4]thiadiazine 1,1-dioxide

CAS: 359-85-3

4H-Benzo[e][1,2,4]thiadiazine 1,1-dioxide

Purity: 98%

Molecular weight: 182.2g/mol

Ref: 54-OR1036476

2H-1λ⁶,2,4-benzothiadiazine-1,1-dione

CAS: 359-85-3

Purity: 98%

Molecular weight: 182.1999969

Ref: 10-F610377

2H-1,2,4-Benzothiadiazine-1,1-dione

CAS: 359-85-3

2H-1,2,4-Benzothiadiazine-1,1-dione is a pharmaceutical agent that belongs to the group of benzothiadiazine compounds. It is used as an intermediate in the synthesis of other drugs and has antihypertensive activity. 2H-1,2,4-Benzothiadiazine-1,1-dione inhibits blood pressure by acting on alpha receptors in vascular smooth muscle cells to inhibit the release of nitric oxide. This drug also blocks the binding of angiotensin II to its receptors and thus reduces the production of aldosterone and other hormones that promote sodium retention. Benzothiadiazine compounds are also known for their ability to form tautomers and isomers with each other. One such example is 2H-1,2,4-benzothiadiazine-1,1-dione (TBDT).

Formula: C₇H₆N₂O₂S

Purity: Min. 95%

Molecular weight: 182.2 g/mol

Ref: 3D-AAA35985