CymitQuimica logo

CAS 3590-07-6

:

2-chloro-N-(2-chloroethyl)-N-ethylethanamine hydrochloride (1:1)

Description:
2-Chloro-N-(2-chloroethyl)-N-ethylethanamine hydrochloride, with the CAS number 3590-07-6, is a chemical compound characterized by its amine functional groups and the presence of chlorine atoms. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility. The compound features a two-chloroethyl group, which contributes to its reactivity and potential applications in organic synthesis or medicinal chemistry. As an amine, it may exhibit basic properties and can participate in various chemical reactions, including nucleophilic substitutions. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure, including irritation to the skin, eyes, and respiratory system. Proper storage conditions are essential to maintain its stability and prevent degradation. Overall, this compound's unique structure and properties make it of interest in various chemical research and industrial applications.
Formula:C6H14Cl3N
InChI:InChI=1/C6H13Cl2N.ClH/c1-2-9(5-3-7)6-4-8;/h2-6H2,1H3;1H
InChI key:NATUMHLLJZPGJW-UHFFFAOYSA-N
SMILES:CCN(CCCl)CCCl.Cl
Synonyms:
  • ethanamine, 2-chloro-N-(2-chloroethyl)-N-ethyl-, hydrochloride (1:1)
  • 2-Chloro-N-(2-chloroethyl)-N-ethylethanamine hydrochloride (1:1)
Found 2 products.