CAS 35905-85-2
:3-Pyridinecarboxylic acid, 2-bromo-
Description:
3-Pyridinecarboxylic acid, 2-bromo- is an organic compound characterized by the presence of a pyridine ring substituted with a carboxylic acid group and a bromine atom. Its molecular structure features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and reactivity. The carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The bromine substituent at the second position of the pyridine ring enhances the compound's reactivity, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. Its unique combination of functional groups allows for diverse applications in chemical synthesis and research. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous.
Formula:C6H4BrNO2
InChI:InChI=1/C6H4BrNO2/c7-5-4(6(9)10)2-1-3-8-5/h1-3H,(H,9,10)
SMILES:c1cc(c(Br)nc1)C(=O)O
Synonyms:- 2-Bromo Nicotinic Acid
- 2-Bromopyridine-3-Carboxylic Acid
- 2-Bromonicotinic Acid
- 2-Bromo-3-Pyridinecarboxylic Acid
- Akos Bbs-00001340
- Iflab-Bb F1921-0015
- Aurora 23320
- 2-Bromo-3-Pyridine Carboxylic
- 2-Bromo-3-pyridine carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromonicotinic acid
CAS:2-Bromonicotinic acidFormula:C6H4BrNO2Purity:≥95%Color and Shape: white to off-white solidMolecular weight:202.01g/mol2-Bromonicotinic Acid
CAS:Formula:C6H4BrNO2Purity:>98.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:202.012-Bromonicotinic acid
CAS:Formula:C6H4BrNO2Purity:97%Color and Shape:Solid, White to pale reddish yellow powderMolecular weight:202.007



