CAS 35909-01-4
:methyl 1-nitroso-L-prolinate
Description:
Methyl 1-nitroso-L-prolinate is a chemical compound characterized by its unique structure, which includes a nitroso group (-NO) attached to the proline amino acid derivative. This compound is typically a pale yellow to orange solid and is soluble in organic solvents such as ethanol and methanol, but less soluble in water. It is known for its potential applications in organic synthesis and as a reagent in various chemical reactions, particularly in the field of medicinal chemistry. The presence of the nitroso group imparts specific reactivity, allowing it to participate in electrophilic reactions. Additionally, methyl 1-nitroso-L-prolinate may exhibit biological activity, making it of interest for research in pharmacology and biochemistry. As with many nitroso compounds, it should be handled with care due to potential toxicity and reactivity. Proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C6H10N2O3
InChI:InChI=1/C6H10N2O3/c1-11-6(9)5-3-2-4-8(5)7-10/h5H,2-4H2,1H3/t5-/m0/s1
Synonyms:- Methyl (S)-1-nitroso-2-pyrrolidinecarboxylate
- 2-Pyrrolidinecarboxylic acid, 1-nitroso-, methyl ester, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
