
CAS 35920-91-3
:Avenacoside B
Description:
Avenacoside B is a saponin compound primarily found in oats, particularly in the species Avena sativa. It is characterized by its glycosidic structure, which consists of a sugar moiety linked to a steroid or triterpenoid aglycone. This compound exhibits various biological activities, including anti-inflammatory, antioxidant, and potential cholesterol-lowering effects, making it of interest in both nutritional and pharmaceutical research. Avenacoside B is also noted for its ability to enhance skin health and may have applications in cosmetic formulations. Its solubility in water and organic solvents varies, which influences its bioavailability and efficacy in different applications. Additionally, it is recognized for its role in plant defense mechanisms, contributing to the plant's resistance against pathogens. Overall, Avenacoside B represents a significant area of study due to its diverse health benefits and potential uses in various industries.
Formula:C57H92O28
InChI:InChI=1S/C57H92O28/c1-21-33-28(84-57(21)13-12-54(3,85-57)20-74-49-41(69)39(67)35(63)29(16-58)77-49)15-27-25-7-6-23-14-24(8-10-55(23,4)26(25)9-11-56(27,33)5)76-53-48(44(72)46(32(19-61)80-53)81-50-42(70)38(66)34(62)22(2)75-50)83-52-45(73)47(37(65)31(18-60)79-52)82-51-43(71)40(68)36(64)30(17-59)78-51/h6,21-22,24-53,58-73H,7-20H2,1-5H3
InChI key:InChIKey=KSQDOQZKXFUZMV-UHFFFAOYSA-N
SMILES:CC12C3C(OC4(C3C)OC(COC5OC(CO)C(O)C(O)C5O)(C)CC4)CC1C6C(CC2)C7(C)C(=CC6)CC(OC8C(OC9C(O)C(OC%10OC(CO)C(O)C(O)C%10O)C(O)C(CO)O9)C(O)C(OC%11C(O)C(O)C(O)C(C)O%11)C(CO)O8)CC7
Synonyms:- (3β,22α,25S)-22,25-Epoxy-26-(β-D-glucopyranosyloxy)furost-5-en-3-yl O-6-deoxy-α-L-mannopyranosyl-(1→4)-O-[O-β-D-glucopyranosyl-(1→3)-β-D-glucopyranosyl-(1→2)]-β-D-glucopyranoside
- Avenacoside B
- Avenacosid B
- β-D-Glucopyranoside, (3β,22α,25S)-22,25-epoxy-26-(β-D-glucopyranosyloxy)furost-5-en-3-yl O-6-deoxy-α-L-mannopyranosyl-(1→4)-O-[O-β-D-glucopyranosyl-(1→3)-β-D-glucopyranosyl-(1→2)]-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery