CAS 35923-65-0
:7-Oxoheptanoic acid
Description:
7-Oxoheptanoic acid, with the CAS number 35923-65-0, is a carboxylic acid characterized by a seven-carbon chain with a ketone functional group at the seventh carbon position. This compound features a molecular structure that includes both a carboxylic acid (-COOH) and a ketone (C=O) group, which contributes to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of both functional groups allows for various chemical reactions, including esterification and condensation, making it useful in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Additionally, 7-oxoheptanoic acid may exhibit biological activity, although specific biological properties would require further investigation. Its solubility in organic solvents and limited solubility in water is typical for medium-chain fatty acids, influencing its behavior in different chemical environments. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H12O3
InChI:InChI=1S/C7H12O3/c8-6-4-2-1-3-5-7(9)10/h6H,1-5H2,(H,9,10)
InChI key:InChIKey=OOFMTFUTWFAVGC-UHFFFAOYSA-N
SMILES:C(CCCC=O)CC(O)=O
Synonyms:- Heptanoic acid, 7-oxo-
- ω-Ketoheptanoic acid
- 7-Oxoheptanoic acid
- 7-Ketoheptanoic acid
- 7-Ketoheptanoic acid
- 6-Formylhexanoic acid
- Heptanoic acid, 7-oxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
7-Oxoheptanoic acid
CAS:7-Oxoheptanoic acid is a synthetic fatty acid that is found in the plasma of humans and other mammals. It is produced by oxidation of cholesterol, which occurs in the liver and small intestine. 7-Oxoheptanoic acid has been shown to be involved in the regulation of gene expression through modifications to DNA and protein targets. This fatty acid also has covalent adducts with plasma proteins such as trypsin and plasmin, which may contribute to its biological activity. 7-Oxoheptanoic acid can be oxidized into reactive oxygen species (ROS) that have been shown to cause oxidative damage to lipids, proteins, and DNA.Formula:C7H12O3Purity:Min. 95%Molecular weight:144.17 g/mol

