
CAS 35930-20-2
:Nomilinic acid
Description:
Nomilinic acid, with the CAS number 35930-20-2, is a chemical compound that belongs to the class of limonoids, which are naturally occurring compounds found in citrus fruits. It is characterized by its unique structure, which includes a complex arrangement of carbon rings and functional groups that contribute to its biological activity. Nomilinic acid is known for its potential health benefits, including anti-inflammatory and antioxidant properties. It has been studied for its effects on various biological pathways, including those related to cancer and metabolic disorders. The compound is typically found in the seeds and peels of citrus fruits, particularly in bitter oranges. Its solubility properties can vary, and it may exhibit different behaviors in various solvents. As with many limonoids, nomilinic acid may also have a bitter taste, which is characteristic of compounds in this class. Overall, nomilinic acid represents a fascinating area of study in natural products chemistry and pharmacology, with ongoing research into its potential applications in health and nutrition.
Formula:C28H36O10
InChI:InChI=1S/C28H36O10/c1-14(29)36-19(12-20(31)32)26(5)16-7-9-25(4)21(15-8-10-35-13-15)37-23(33)22-28(25,38-22)27(16,6)18(30)11-17(26)24(2,3)34/h8,10,13,16-17,19,21-22,34H,7,9,11-12H2,1-6H3,(H,31,32)/t16-,17+,19-,21+,22-,25+,26-,27+,28-/m1/s1
InChI key:InChIKey=ZIKZPLSIAVHITA-HNABCYPOSA-N
SMILES:C[C@]12[C@]34[C@](C)([C@@H](OC(=O)[C@]3(O4)[H])C=5C=COC5)CC[C@@]1([C@]([C@@H](CC(O)=O)OC(C)=O)(C)[C@H](C(C)(C)O)CC2=O)[H]
Synonyms:- Naphth[2,1-c]oxireno[d]pyran-6-propanoic acid, β-(acetyloxy)-3-(3-furanyl)dodecahydro-7-(1-hydroxy-1-methylethyl)-3a,6,9a-trimethyl-1,9-dioxo-, (βR,3S,3aS,5aR,6R,7R,9aR,9bR,10aS)-
- Nomilinic acid
- (βR,3S,3aS,5aR,6R,7R,9aR,9bR,10aS)-β-(Acetyloxy)-3-(3-furanyl)dodecahydro-7-(1-hydroxy-1-methylethyl)-3a,6,9a-trimethyl-1,9-dioxonaphth[2,1-c]oxireno[d]pyran-6-propanoic acid
- Obacunoic acid, 1-(acetyloxy)-1,2-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Nomilinic acid
CAS:<p>Nomilinic acid is a useful organic compound for research related to life sciences. The catalog number is T124959 and the CAS number is 35930-20-2.</p>Formula:C28H36O10Color and Shape:SolidMolecular weight:532.586
